C18H16N2O3 — CID 90387097
3-[[cyano-(2-phenoxyphenyl)methyl]amino]but-2-enoic acid (PubChem CID 90387097) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-[[cyano-(2-phenoxyphenyl)methyl]amino]but-2-enoic acid.
| Compound Name | 3-[[cyano-(2-phenoxyphenyl)methyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 90387097 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[[cyano-(2-phenoxyphenyl)methyl]amino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)NC(C#N)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-13(11-18(21)22)20-16(12-19)15-9-5-6-10-17(15)23-14-7-3-2-4-8-14/h2-11,16,20H,1H3,(H,21,22) |
| InChIKey | KSWKIVRBPSVTOM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|