C52H48O6 — CID 90394301
4-[2-[9-[[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]methyl]-2-[7-(2-methylpropyl)pyren-1-yl]fluoren-9-yl]ethyl]-2,6-bis(hydroxymethyl)phenol (PubChem CID 90394301) has the molecular formula C52H48O6 and a molecular weight of 768.95 g/mol. Its IUPAC name is 4-[2-[9-[[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]methyl]-2-[7-(2-methylpropyl)pyren-1-yl]fluoren-9-yl]ethyl]-2,6-bis(hydroxymethyl)phenol.
| Compound Name | 4-[2-[9-[[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]methyl]-2-[7-(2-methylpropyl)pyren-1-yl]fluoren-9-yl]ethyl]-2,6-bis(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 90394301 |
| Molecular Formula | C52H48O6 |
| Molecular Weight | 768.95 g/mol |
| Exact Mass | 768.35 |
| IUPAC Name | 4-[2-[9-[[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]methyl]-2-[7-(2-methylpropyl)pyren-1-yl]fluoren-9-yl]ethyl]-2,6-bis(hydroxymethyl)phenol |
| SMILES | CC(C)Cc1cc2ccc3ccc(-c4ccc5c(c4)C(CCc4cc(CO)c(O)c(CO)c4)(Cc4cc(CO)c(O)c(CO)c4)c4ccccc4-5)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C52H48O6/c1-30(2)17-32-20-36-8-7-34-9-12-42(45-14-11-37(21-32)48(36)49(34)45)35-10-13-44-43-5-3-4-6-46(43)52(47(44)24-35,25-33-22-40(28-55)51(58)41(23-33)29-56)16-15-31-18-38(26-53)50(57)39(19-31)27-54/h3-14,18-24,30,53-58H,15-17,25-29H2,1-2H3 |
| InChIKey | VYHRDWHRHGMEDR-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.95 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|