C24H28F2N2O2S — CID 90401791
1-[5-fluoro-1-[(3-fluorophenyl)methyl]-6-[[1-(sulfinoamino)cyclobutyl]methyl]-2,3-dihydro-1H-inden-2-yl]azetidine (PubChem CID 90401791) has the molecular formula C24H28F2N2O2S and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[5-fluoro-1-[(3-fluorophenyl)methyl]-6-[[1-(sulfinoamino)cyclobutyl]methyl]-2,3-dihydro-1H-inden-2-yl]azetidine.
| Compound Name | 1-[5-fluoro-1-[(3-fluorophenyl)methyl]-6-[[1-(sulfinoamino)cyclobutyl]methyl]-2,3-dihydro-1H-inden-2-yl]azetidine |
|---|---|
| PubChem CID | 90401791 |
| Molecular Formula | C24H28F2N2O2S |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[5-fluoro-1-[(3-fluorophenyl)methyl]-6-[[1-(sulfinoamino)cyclobutyl]methyl]-2,3-dihydro-1H-inden-2-yl]azetidine |
| SMILES | O=S(O)NC1(Cc2cc3c(cc2F)CC(N2CCC2)C3Cc2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C24H28F2N2O2S/c25-19-5-1-4-16(10-19)11-21-20-12-18(15-24(6-2-7-24)27-31(29)30)22(26)13-17(20)14-23(21)28-8-3-9-28/h1,4-5,10,12-13,21,23,27H,2-3,6-9,11,14-15H2,(H,29,30) |
| InChIKey | SJBUEKOPIKQVLR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|