C20H23F3N4O6 — CID 90402767
7-ethyl-1-(3-hydroxypropyl)-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 90402767) has the molecular formula C20H23F3N4O6 and a molecular weight of 472.42 g/mol. Its IUPAC name is 7-ethyl-1-(3-hydroxypropyl)-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
| Compound Name | 7-ethyl-1-(3-hydroxypropyl)-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90402767 |
| Molecular Formula | C20H23F3N4O6 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 7-ethyl-1-(3-hydroxypropyl)-3-methyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | CCn1c(OCCOc2cccc(OC(F)(F)F)c2)nc2c1c(=O)n(CCCO)c(=O)n2C |
| InChI | InChI=1S/C20H23F3N4O6/c1-3-26-15-16(25(2)19(30)27(17(15)29)8-5-9-28)24-18(26)32-11-10-31-13-6-4-7-14(12-13)33-20(21,22)23/h4,6-7,12,28H,3,5,8-11H2,1-2H3 |
| InChIKey | SQODOUHZYSARGN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|