C22H19BrN4O4 — CID 90403825
8-(3-acetylphenoxy)-7-[(3-bromophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 90403825) has the molecular formula C22H19BrN4O4 and a molecular weight of 483.32 g/mol. Its IUPAC name is 8-(3-acetylphenoxy)-7-[(3-bromophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(3-acetylphenoxy)-7-[(3-bromophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 90403825 |
| Molecular Formula | C22H19BrN4O4 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 8-(3-acetylphenoxy)-7-[(3-bromophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(=O)c1cccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C22H19BrN4O4/c1-13(28)15-7-5-9-17(11-15)31-21-24-19-18(20(29)26(3)22(30)25(19)2)27(21)12-14-6-4-8-16(23)10-14/h4-11H,12H2,1-3H3 |
| InChIKey | YHJIFDCDMIKEMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |