C21H16N2O5S — CID 90407378
(E)-N-[4-(1,3-benzodioxol-5-ylsulfonyl)phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 90407378) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzodioxol-5-ylsulfonyl)phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzodioxol-5-ylsulfonyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 90407378 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (E)-N-[4-(1,3-benzodioxol-5-ylsulfonyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1ccc(S(=O)(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H16N2O5S/c24-21(10-3-15-2-1-11-22-13-15)23-16-4-6-17(7-5-16)29(25,26)18-8-9-19-20(12-18)28-14-27-19/h1-13H,14H2,(H,23,24)/b10-3+ |
| InChIKey | FWQNJYIZWJULAZ-XCVCLJGOSA-N |
| XLogP | 3.30 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|