C30H32N8O3 — CID 90408483
1-(4-tert-butylphenyl)-3-[3-[7-oxo-11-(oxolan-2-ylmethylamino)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-8-yl]phenyl]urea (PubChem CID 90408483) has the molecular formula C30H32N8O3 and a molecular weight of 552.64 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-[7-oxo-11-(oxolan-2-ylmethylamino)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-8-yl]phenyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-[7-oxo-11-(oxolan-2-ylmethylamino)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-8-yl]phenyl]urea |
|---|---|
| PubChem CID | 90408483 |
| Molecular Formula | C30H32N8O3 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-[7-oxo-11-(oxolan-2-ylmethylamino)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-8-yl]phenyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cccc(-n3c(=O)c4cn[nH]c4c4cnc(NCC5CCCO5)nc43)c2)cc1 |
| InChI | InChI=1S/C30H32N8O3/c1-30(2,3)18-9-11-19(12-10-18)34-29(40)35-20-6-4-7-21(14-20)38-26-23(25-24(27(38)39)17-33-37-25)16-32-28(36-26)31-15-22-8-5-13-41-22/h4,6-7,9-12,14,16-17,22H,5,8,13,15H2,1-3H3,(H,33,37)(H,31,32,36)(H2,34,35,40) |
| InChIKey | WPCITCWQWFWJGA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |