C19H19N7O2 — CID 90407721
5-amino-11-(oxolan-2-ylmethylamino)-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 90407721) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 5-amino-11-(oxolan-2-ylmethylamino)-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 5-amino-11-(oxolan-2-ylmethylamino)-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 90407721 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 5-amino-11-(oxolan-2-ylmethylamino)-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | Nc1n[nH]c2c1c(=O)n(-c1ccccc1)c1nc(NCC3CCCO3)ncc21 |
| InChI | InChI=1S/C19H19N7O2/c20-16-14-15(24-25-16)13-10-22-19(21-9-12-7-4-8-28-12)23-17(13)26(18(14)27)11-5-2-1-3-6-11/h1-3,5-6,10,12H,4,7-9H2,(H3,20,24,25)(H,21,22,23) |
| InChIKey | HLUVDCMOGJYJTB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |