C28H41N3O7 — CID 90411852
3-[2-[3-[3-[4-[4-(3-aminopropoxy)benzoyl]anilino]propoxy]propoxy]ethoxy]propylcarbamic acid (PubChem CID 90411852) has the molecular formula C28H41N3O7 and a molecular weight of 531.65 g/mol. Its IUPAC name is 3-[2-[3-[3-[4-[4-(3-aminopropoxy)benzoyl]anilino]propoxy]propoxy]ethoxy]propylcarbamic acid.
| Compound Name | 3-[2-[3-[3-[4-[4-(3-aminopropoxy)benzoyl]anilino]propoxy]propoxy]ethoxy]propylcarbamic acid |
|---|---|
| PubChem CID | 90411852 |
| Molecular Formula | C28H41N3O7 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 3-[2-[3-[3-[4-[4-(3-aminopropoxy)benzoyl]anilino]propoxy]propoxy]ethoxy]propylcarbamic acid |
| SMILES | NCCCOc1ccc(C(=O)c2ccc(NCCCOCCCOCCOCCCNC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H41N3O7/c29-13-1-20-38-26-11-7-24(8-12-26)27(32)23-5-9-25(10-6-23)30-14-2-16-35-18-4-19-37-22-21-36-17-3-15-31-28(33)34/h5-12,30-31H,1-4,13-22,29H2,(H,33,34) |
| InChIKey | SYOXTGBUBLAGCU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|