C14H22O6 — CID 90416995
dipropan-2-yl 4-methyl-2,6-dioxoheptanedioate (PubChem CID 90416995) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is dipropan-2-yl 4-methyl-2,6-dioxoheptanedioate.
| Compound Name | dipropan-2-yl 4-methyl-2,6-dioxoheptanedioate |
|---|---|
| PubChem CID | 90416995 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | dipropan-2-yl 4-methyl-2,6-dioxoheptanedioate |
| SMILES | CC(CC(=O)C(=O)OC(C)C)CC(=O)C(=O)OC(C)C |
| InChI | InChI=1S/C14H22O6/c1-8(2)19-13(17)11(15)6-10(5)7-12(16)14(18)20-9(3)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | GMRNMNAEHMFBRC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|