C28H24ClN9O6 — CID 90417542
[4-[[6-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-8,8-dimethyl-3-nitro-5,7-dihydro-1,6-naphthyridine-5-carbonyl]amino]phenyl]carbamic acid (PubChem CID 90417542) has the molecular formula C28H24ClN9O6 and a molecular weight of 618.01 g/mol. Its IUPAC name is [4-[[6-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-8,8-dimethyl-3-nitro-5,7-dihydro-1,6-naphthyridine-5-carbonyl]amino]phenyl]carbamic acid.
| Compound Name | [4-[[6-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-8,8-dimethyl-3-nitro-5,7-dihydro-1,6-naphthyridine-5-carbonyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 90417542 |
| Molecular Formula | C28H24ClN9O6 |
| Molecular Weight | 618.01 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | [4-[[6-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-8,8-dimethyl-3-nitro-5,7-dihydro-1,6-naphthyridine-5-carbonyl]amino]phenyl]carbamic acid |
| SMILES | CC1(C)CN(C(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)C(C(=O)Nc2ccc(NC(=O)O)cc2)c2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C28H24ClN9O6/c1-28(2)14-36(23(39)10-3-16-11-17(29)4-9-22(16)37-15-31-34-35-37)24(21-12-20(38(43)44)13-30-25(21)28)26(40)32-18-5-7-19(8-6-18)33-27(41)42/h3-13,15,24,33H,14H2,1-2H3,(H,32,40)(H,41,42)/b10-3+ |
| InChIKey | ZSDJPUAWQCKKGR-XCVCLJGOSA-N |
| XLogP | 4.22 |
| TPSA | 198.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|