C16H26O6 — CID 90417667
6-(2,7-dimethyloctan-4-yloxy)-2,5,6-trioxohexanoic acid (PubChem CID 90417667) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-(2,7-dimethyloctan-4-yloxy)-2,5,6-trioxohexanoic acid.
| Compound Name | 6-(2,7-dimethyloctan-4-yloxy)-2,5,6-trioxohexanoic acid |
|---|---|
| PubChem CID | 90417667 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-(2,7-dimethyloctan-4-yloxy)-2,5,6-trioxohexanoic acid |
| SMILES | CC(C)CCC(CC(C)C)OC(=O)C(=O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C16H26O6/c1-10(2)5-6-12(9-11(3)4)22-16(21)14(18)8-7-13(17)15(19)20/h10-12H,5-9H2,1-4H3,(H,19,20) |
| InChIKey | PBIDAHPYTBMOHI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|