C17H29BrN2O2S — CID 90421780
3-(4-bromophenyl)-1-methylsulfonylpyrrolidine;N,N-diethylethanamine (PubChem CID 90421780) has the molecular formula C17H29BrN2O2S and a molecular weight of 405.40 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-methylsulfonylpyrrolidine;N,N-diethylethanamine.
| Compound Name | 3-(4-bromophenyl)-1-methylsulfonylpyrrolidine;N,N-diethylethanamine |
|---|---|
| PubChem CID | 90421780 |
| Molecular Formula | C17H29BrN2O2S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-(4-bromophenyl)-1-methylsulfonylpyrrolidine;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.CS(=O)(=O)N1CCC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C11H14BrNO2S.C6H15N/c1-16(14,15)13-7-6-10(8-13)9-2-4-11(12)5-3-9;1-4-7(5-2)6-3/h2-5,10H,6-8H2,1H3;4-6H2,1-3H3 |
| InChIKey | DJGNLDNMNWJMRS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |