C26H32N4O2P+ — CID 90424170
2-[2-[[2-(diaminomethylideneamino)-2-oxoethyl]-methylamino]ethoxy]ethyl-triphenylphosphanium (PubChem CID 90424170) has the molecular formula C26H32N4O2P+ and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[2-[[2-(diaminomethylideneamino)-2-oxoethyl]-methylamino]ethoxy]ethyl-triphenylphosphanium.
| Compound Name | 2-[2-[[2-(diaminomethylideneamino)-2-oxoethyl]-methylamino]ethoxy]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 90424170 |
| Molecular Formula | C26H32N4O2P+ |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-[2-[[2-(diaminomethylideneamino)-2-oxoethyl]-methylamino]ethoxy]ethyl-triphenylphosphanium |
| SMILES | CN(CCOCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)N=C(N)N |
| InChI | InChI=1S/C26H31N4O2P/c1-30(21-25(31)29-26(27)28)17-18-32-19-20-33(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16H,17-21H2,1H3,(H3-,27,28,29,31)/p+1 |
| InChIKey | RIINDQYYWIQHKL-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|