C9H16N2O4 — CID 90424477
2-[2-(1H-imidazol-1-ium-1-yl)ethoxy]ethanol acetate (PubChem CID 90424477) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-1-ium-1-yl)ethoxy]ethanol acetate.
| Compound Name | 2-[2-(1H-imidazol-1-ium-1-yl)ethoxy]ethanol acetate |
|---|---|
| PubChem CID | 90424477 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[2-(1H-imidazol-1-ium-1-yl)ethoxy]ethanol acetate |
| SMILES | CC(=O)[O-].OCCOCC[NH+]1C=CN=C1 |
| InChI | InChI=1S/C7H12N2O2.C2H4O2/c10-4-6-11-5-3-9-2-1-8-7-9;1-2(3)4/h1-2,7,10H,3-6H2;1H3,(H,3,4) |
| InChIKey | OSQGWKGPOJCZNV-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|