About ethylphosphanium;tetracyanoboranuide
ethylphosphanium;tetracyanoboranuide (PubChem CID 90426635) has the molecular formula C6H8BN4P
and a molecular weight of 177.94 g/mol. Its IUPAC name is ethylphosphanium;tetracyanoboranuide.
Molecular Properties
| Compound Name | ethylphosphanium;tetracyanoboranuide |
| PubChem CID | 90426635 |
| Molecular Formula | C6H8BN4P |
| Molecular Weight | 177.94 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | ethylphosphanium;tetracyanoboranuide |
| SMILES | CC[PH3+].N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C4BN4.C2H7P/c6-1-5(2-7,3-8)4-9;1-2-3/h;2-3H2,1H3/q-1;/p+1 |
| InChIKey | ZMNNLHFVGHHIER-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.94 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethylphosphanium;tetracyanoboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylphosphanium;tetracyanoboranuide?
The IUPAC name of ethylphosphanium;tetracyanoboranuide (CID 90426635) is ethylphosphanium;tetracyanoboranuide.
What is the SMILES notation for ethylphosphanium;tetracyanoboranuide?
The canonical SMILES for ethylphosphanium;tetracyanoboranuide is CC[PH3+].N#C[B-](C#N)(C#N)C#N.
What is the InChIKey of ethylphosphanium;tetracyanoboranuide?
The InChIKey is ZMNNLHFVGHHIER-UHFFFAOYSA-O. The full InChI is InChI=1S/C4BN4.C2H7P/c6-1-5(2-7,3-8)4-9;1-2-3/h;2-3H2,1H3/q-1;/p+1.
What are the key properties of ethylphosphanium;tetracyanoboranuide?
ethylphosphanium;tetracyanoboranuide has a molecular weight of 177.94 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylphosphanium;tetracyanoboranuide is sourced from PubChem (CID 90426635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).