About tetrabutylphosphanium;tetracyanoboranuide
tetrabutylphosphanium;tetracyanoboranuide (PubChem CID 87443480) has the molecular formula C20H36BN4P
and a molecular weight of 374.32 g/mol. Its IUPAC name is tetrabutylphosphanium;tetracyanoboranuide.
Molecular Properties
| Compound Name | tetrabutylphosphanium;tetracyanoboranuide |
| PubChem CID | 87443480 |
| Molecular Formula | C20H36BN4P |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | tetrabutylphosphanium;tetracyanoboranuide |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C16H36P.C4BN4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-1-5(2-7,3-8)4-9/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | SIIHZNUTRVZBPI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylphosphanium;tetracyanoboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylphosphanium;tetracyanoboranuide?
The IUPAC name of tetrabutylphosphanium;tetracyanoboranuide (CID 87443480) is tetrabutylphosphanium;tetracyanoboranuide.
What is the SMILES notation for tetrabutylphosphanium;tetracyanoboranuide?
The canonical SMILES for tetrabutylphosphanium;tetracyanoboranuide is CCCC[P+](CCCC)(CCCC)CCCC.N#C[B-](C#N)(C#N)C#N.
What is the InChIKey of tetrabutylphosphanium;tetracyanoboranuide?
The InChIKey is SIIHZNUTRVZBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C4BN4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-1-5(2-7,3-8)4-9/h5-16H2,1-4H3;/q+1;-1.
What are the key properties of tetrabutylphosphanium;tetracyanoboranuide?
tetrabutylphosphanium;tetracyanoboranuide has a molecular weight of 374.32 g/mol, XLogP of 5.89, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylphosphanium;tetracyanoboranuide is sourced from PubChem (CID 87443480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).