C19H24N4O5S — CID 90427788
[[(1S)-1-(4-ethyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethyl]amino]-[(2S)-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 90427788) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is [[(1S)-1-(4-ethyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethyl]amino]-[(2S)-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [[(1S)-1-(4-ethyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethyl]amino]-[(2S)-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90427788 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [[(1S)-1-(4-ethyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethyl]amino]-[(2S)-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc([N+](=O)[O-])cc2)NN(C(=O)O)[C@H](C=O)C(C)C)n1 |
| InChI | InChI=1S/C19H24N4O5S/c1-4-14-11-29-18(20-14)16(9-13-5-7-15(8-6-13)23(27)28)21-22(19(25)26)17(10-24)12(2)3/h5-8,10-12,16-17,21H,4,9H2,1-3H3,(H,25,26)/t16-,17+/m0/s1 |
| InChIKey | IQEAJJLHFSOFOS-DLBZAZTESA-N |
| XLogP | 3.61 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|