C15H17N3O4S — CID 139073929
(4-nitrophenyl) N-methyl-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate (PubChem CID 139073929) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is (4-nitrophenyl) N-methyl-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate.
| Compound Name | (4-nitrophenyl) N-methyl-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 139073929 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (4-nitrophenyl) N-methyl-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate |
| SMILES | CC(C)c1nc(CN(C)C(=O)Oc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C15H17N3O4S/c1-10(2)14-16-11(9-23-14)8-17(3)15(19)22-13-6-4-12(5-7-13)18(20)21/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | TYJMTRDBWQZYMQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|