C16H19N3O4S — CID 91147770
(4-nitrophenyl) N-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]carbamate (PubChem CID 91147770) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is (4-nitrophenyl) N-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]carbamate.
| Compound Name | (4-nitrophenyl) N-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 91147770 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (4-nitrophenyl) N-tert-butyl-N-[2-(1,3-thiazol-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)N(CCc1cscn1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-16(2,3)18(9-8-12-10-24-11-17-12)15(20)23-14-6-4-13(5-7-14)19(21)22/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | GPBHOHNWTJZGHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|