C23H24N4O5S — CID 140899927
[(2S)-1-[[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]amino]-3-phenylpropan-2-yl] N-oxocarbamate (PubChem CID 140899927) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]amino]-3-phenylpropan-2-yl] N-oxocarbamate.
| Compound Name | [(2S)-1-[[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]amino]-3-phenylpropan-2-yl] N-oxocarbamate |
|---|---|
| PubChem CID | 140899927 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [(2S)-1-[[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]amino]-3-phenylpropan-2-yl] N-oxocarbamate |
| SMILES | CCc1nc([C@H](Cc2ccc([N+](=O)[O-])cc2)NC[C@H](Cc2ccccc2)OC(=O)N=O)cs1 |
| InChI | InChI=1S/C23H24N4O5S/c1-2-22-25-21(15-33-22)20(13-17-8-10-18(11-9-17)27(30)31)24-14-19(32-23(28)26-29)12-16-6-4-3-5-7-16/h3-11,15,19-20,24H,2,12-14H2,1H3/t19-,20-/m0/s1 |
| InChIKey | JIBPQEGJXBNDNZ-PMACEKPBSA-N |
| XLogP | 5.00 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|