C24H28N4O3S — CID 66695030
methyl N-[3-[[(1S)-2-(4-aminophenyl)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]amino]-3-oxo-2-phenylpropyl]carbamate (PubChem CID 66695030) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is methyl N-[3-[[(1S)-2-(4-aminophenyl)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]amino]-3-oxo-2-phenylpropyl]carbamate.
| Compound Name | methyl N-[3-[[(1S)-2-(4-aminophenyl)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]amino]-3-oxo-2-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 66695030 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | methyl N-[3-[[(1S)-2-(4-aminophenyl)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]amino]-3-oxo-2-phenylpropyl]carbamate |
| SMILES | CCc1nc([C@H](Cc2ccc(N)cc2)NC(=O)C(CNC(=O)OC)c2ccccc2)cs1 |
| InChI | InChI=1S/C24H28N4O3S/c1-3-22-27-21(15-32-22)20(13-16-9-11-18(25)12-10-16)28-23(29)19(14-26-24(30)31-2)17-7-5-4-6-8-17/h4-12,15,19-20H,3,13-14,25H2,1-2H3,(H,26,30)(H,28,29)/t19?,20-/m0/s1 |
| InChIKey | DACBHZLWTGYUDW-ANYOKISRSA-N |
| XLogP | 3.83 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|