C14H27N3O4 — CID 90429913
(2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-hydroxyacetyl]-methylamino]-4-methylpentanamide (PubChem CID 90429913) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-hydroxyacetyl]-methylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-hydroxyacetyl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 90429913 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-hydroxyacetyl]-methylamino]-4-methylpentanamide |
| SMILES | CCCC(=O)N(C)[C@H](O)C(=O)N(C)[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H27N3O4/c1-6-7-11(18)17(5)14(21)13(20)16(4)10(12(15)19)8-9(2)3/h9-10,14,21H,6-8H2,1-5H3,(H2,15,19)/t10-,14+/m0/s1 |
| InChIKey | ZYMJAJDCEBZYBR-IINYFYTJSA-N |
| XLogP | -0.08 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|