C17H33N3O3S — CID 118882604
(2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-propan-2-ylsulfanylacetyl]-methylamino]-4-methylpentanamide (PubChem CID 118882604) has the molecular formula C17H33N3O3S and a molecular weight of 359.54 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-propan-2-ylsulfanylacetyl]-methylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-propan-2-ylsulfanylacetyl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 118882604 |
| Molecular Formula | C17H33N3O3S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-propan-2-ylsulfanylacetyl]-methylamino]-4-methylpentanamide |
| SMILES | CCCC(=O)N(C)[C@H](SC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C17H33N3O3S/c1-8-9-14(21)20(7)17(24-12(4)5)16(23)19(6)13(15(18)22)10-11(2)3/h11-13,17H,8-10H2,1-7H3,(H2,18,22)/t13-,17+/m0/s1 |
| InChIKey | AQLQKTVLJDWJDT-SUMWQHHRSA-N |
| XLogP | 2.07 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|