C23H46N4O4S — CID 129027932
(2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-[3-[ethyl(propan-2-yl)amino]propylsulfanyl]acetyl]-methylamino]-4-methoxy-4-methylpentanamide (PubChem CID 129027932) has the molecular formula C23H46N4O4S and a molecular weight of 474.71 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-[3-[ethyl(propan-2-yl)amino]propylsulfanyl]acetyl]-methylamino]-4-methoxy-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-[3-[ethyl(propan-2-yl)amino]propylsulfanyl]acetyl]-methylamino]-4-methoxy-4-methylpentanamide |
|---|---|
| PubChem CID | 129027932 |
| Molecular Formula | C23H46N4O4S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2S)-2-[[(2R)-2-[butanoyl(methyl)amino]-2-[3-[ethyl(propan-2-yl)amino]propylsulfanyl]acetyl]-methylamino]-4-methoxy-4-methylpentanamide |
| SMILES | CCCC(=O)N(C)[C@H](SCCCN(CC)C(C)C)C(=O)N(C)[C@@H](CC(C)(C)OC)C(N)=O |
| InChI | InChI=1S/C23H46N4O4S/c1-10-13-19(28)26(8)22(32-15-12-14-27(11-2)17(3)4)21(30)25(7)18(20(24)29)16-23(5,6)31-9/h17-18,22H,10-16H2,1-9H3,(H2,24,29)/t18-,22+/m0/s1 |
| InChIKey | TWVFFRZUHGLAAJ-PGRDOPGGSA-N |
| XLogP | 2.55 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|