C17H30N2O4 — CID 90430056
[(E,3R,4R)-1-amino-4-methyl-2-[methyl(3-methylbutanoyl)amino]-1-oxooct-6-en-3-yl] acetate (PubChem CID 90430056) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is [(E,3R,4R)-1-amino-4-methyl-2-[methyl(3-methylbutanoyl)amino]-1-oxooct-6-en-3-yl] acetate.
| Compound Name | [(E,3R,4R)-1-amino-4-methyl-2-[methyl(3-methylbutanoyl)amino]-1-oxooct-6-en-3-yl] acetate |
|---|---|
| PubChem CID | 90430056 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [(E,3R,4R)-1-amino-4-methyl-2-[methyl(3-methylbutanoyl)amino]-1-oxooct-6-en-3-yl] acetate |
| SMILES | C/C=C/C[C@@H](C)[C@@H](OC(C)=O)C(C(N)=O)N(C)C(=O)CC(C)C |
| InChI | InChI=1S/C17H30N2O4/c1-7-8-9-12(4)16(23-13(5)20)15(17(18)22)19(6)14(21)10-11(2)3/h7-8,11-12,15-16H,9-10H2,1-6H3,(H2,18,22)/b8-7+/t12-,15?,16-/m1/s1 |
| InChIKey | FKNHNWGIFPZJJX-AXOMBPLISA-N |
| XLogP | 1.88 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|