C7H14N2O2 — CID 121479139
N-carbamoyl-N,3-dimethylbutanamide (PubChem CID 121479139) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N-carbamoyl-N,3-dimethylbutanamide.
| Compound Name | N-carbamoyl-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 121479139 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N-carbamoyl-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)C(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-5(2)4-6(10)9(3)7(8)11/h5H,4H2,1-3H3,(H2,8,11) |
| InChIKey | UAFZZICIPBIRQO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |