C10H11NO4 — CID 90431979
8-aminooxy-7-methoxy-1,4-dihydroisochromen-3-one (PubChem CID 90431979) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 8-aminooxy-7-methoxy-1,4-dihydroisochromen-3-one.
| Compound Name | 8-aminooxy-7-methoxy-1,4-dihydroisochromen-3-one |
|---|---|
| PubChem CID | 90431979 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 8-aminooxy-7-methoxy-1,4-dihydroisochromen-3-one |
| SMILES | COc1ccc2c(c1ON)COC(=O)C2 |
| InChI | InChI=1S/C10H11NO4/c1-13-8-3-2-6-4-9(12)14-5-7(6)10(8)15-11/h2-3H,4-5,11H2,1H3 |
| InChIKey | FOSQRKKQRGLNMU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|