C25H30FNO8 — CID 90441526
[2-fluoro-5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 90441526) has the molecular formula C25H30FNO8 and a molecular weight of 491.51 g/mol. Its IUPAC name is [2-fluoro-5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-fluoro-5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 90441526 |
| Molecular Formula | C25H30FNO8 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [2-fluoro-5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(-c2ccc(F)c(C(=O)N3CCOCC3)c2)ccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C25H30FNO8/c1-14-11-15(16-3-5-18(26)17(12-16)23(31)27-7-9-33-10-8-27)4-6-19(14)34-24-25(2,32)22(30)21(29)20(13-28)35-24/h3-6,11-12,20-22,24,28-30,32H,7-10,13H2,1-2H3/t20-,21-,22+,24+,25+/m1/s1 |
| InChIKey | HWQCOUZLZIEGJV-BRPWVORNSA-N |
| XLogP | 0.84 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |