C21H25ClO6 — CID 90441523
(2R,3S,4S,5S,6R)-2-[4-(5-chloro-2-methylphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol (PubChem CID 90441523) has the molecular formula C21H25ClO6 and a molecular weight of 408.88 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[4-(5-chloro-2-methylphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[4-(5-chloro-2-methylphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 90441523 |
| Molecular Formula | C21H25ClO6 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[4-(5-chloro-2-methylphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
| SMILES | Cc1cc(-c2cc(Cl)ccc2C)ccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C21H25ClO6/c1-11-4-6-14(22)9-15(11)13-5-7-16(12(2)8-13)27-20-21(3,26)19(25)18(24)17(10-23)28-20/h4-9,17-20,23-26H,10H2,1-3H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | ICSSNXGJURESSC-MJCUULBUSA-N |
| XLogP | 2.19 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |