C22H26FNO7 — CID 90402216
3-fluoro-N-methyl-5-[3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzamide (PubChem CID 90402216) has the molecular formula C22H26FNO7 and a molecular weight of 435.45 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-[3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzamide.
| Compound Name | 3-fluoro-N-methyl-5-[3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 90402216 |
| Molecular Formula | C22H26FNO7 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-fluoro-N-methyl-5-[3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzamide |
| SMILES | CNC(=O)c1cc(F)cc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@]3(C)O)c(C)c2)c1 |
| InChI | InChI=1S/C22H26FNO7/c1-11-6-12(13-7-14(20(28)24-3)9-15(23)8-13)4-5-16(11)30-21-22(2,29)19(27)18(26)17(10-25)31-21/h4-9,17-19,21,25-27,29H,10H2,1-3H3,(H,24,28)/t17-,18-,19+,21+,22-/m1/s1 |
| InChIKey | JFZDVRAIFFTWFF-PIBZIWMISA-N |
| XLogP | 0.73 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |