C22H28O8 — CID 85471358
(2R,3S,4S,5S,6R)-2-[4-(2,5-dimethoxyphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol (PubChem CID 85471358) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[4-(2,5-dimethoxyphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[4-(2,5-dimethoxyphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 85471358 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[4-(2,5-dimethoxyphenyl)-2-methylphenoxy]-6-(hydroxymethyl)-3-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(OC)c(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@]3(C)O)c(C)c2)c1 |
| InChI | InChI=1S/C22H28O8/c1-12-9-13(15-10-14(27-3)6-8-17(15)28-4)5-7-16(12)29-21-22(2,26)20(25)19(24)18(11-23)30-21/h5-10,18-21,23-26H,11H2,1-4H3/t18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | GHJGZYOYMADVRN-AANPDWTMSA-N |
| XLogP | 1.25 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |