C22H26O8 — CID 85471159
methyl 3-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzoate (PubChem CID 85471159) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is methyl 3-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 3-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 85471159 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 3-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@]3(C)O)c(C)c2)c1 |
| InChI | InChI=1S/C22H26O8/c1-12-9-14(13-5-4-6-15(10-13)20(26)28-3)7-8-16(12)29-21-22(2,27)19(25)18(24)17(11-23)30-21/h4-10,17-19,21,23-25,27H,11H2,1-3H3/t17-,18-,19+,21+,22+/m1/s1 |
| InChIKey | MGURXUBSXTZMKO-DGYCAGFBSA-N |
| XLogP | 1.02 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |