C22H26N3O2+ — CID 9044456
ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]azanium (PubChem CID 9044456) has the molecular formula C22H26N3O2+ and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]azanium.
| Compound Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9044456 |
| Molecular Formula | C22H26N3O2+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)CC(=O)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c1-3-23-20(27)15-25(4-2)14-19(26)21-17-12-8-9-13-18(17)24-22(21)16-10-6-5-7-11-16/h5-13,24H,3-4,14-15H2,1-2H3,(H,23,27)/p+1 |
| InChIKey | NELPEKNSIWQVBR-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |