C21H14F3N5O3S — CID 90448775
1-(3-nitrophenyl)-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyrazole-3-carboxamide (PubChem CID 90448775) has the molecular formula C21H14F3N5O3S and a molecular weight of 473.44 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-nitrophenyl)-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90448775 |
| Molecular Formula | C21H14F3N5O3S |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-(3-nitrophenyl)-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(C(F)(F)F)cc2)s1)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H14F3N5O3S/c22-21(23,24)14-6-4-13(5-7-14)10-17-12-25-20(33-17)26-19(30)18-8-9-28(27-18)15-2-1-3-16(11-15)29(31)32/h1-9,11-12H,10H2,(H,25,26,30) |
| InChIKey | NQCYVRKGOMJPKT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|