C23H34N2O5Si — CID 90449756
1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-formylspiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate (PubChem CID 90449756) has the molecular formula C23H34N2O5Si and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-formylspiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-formylspiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 90449756 |
| Molecular Formula | C23H34N2O5Si |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-formylspiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CN(C(=O)OCC[Si](C)(C)C)c1ccc(C=O)cc12 |
| InChI | InChI=1S/C23H34N2O5Si/c1-22(2,3)30-20(27)24-10-9-23(15-24)16-25(21(28)29-11-12-31(4,5)6)19-8-7-17(14-26)13-18(19)23/h7-8,13-14H,9-12,15-16H2,1-6H3 |
| InChIKey | MVHCZJOZRDIKTO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|