C28H44N2O6Si — CID 90449861
1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-(4-ethoxy-4-oxobutyl)spiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate (PubChem CID 90449861) has the molecular formula C28H44N2O6Si and a molecular weight of 532.75 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-(4-ethoxy-4-oxobutyl)spiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-(4-ethoxy-4-oxobutyl)spiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 90449861 |
| Molecular Formula | C28H44N2O6Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 1-O'-tert-butyl 1-O-(2-trimethylsilylethyl) 5-(4-ethoxy-4-oxobutyl)spiro[2H-indole-3,3'-pyrrolidine]-1,1'-dicarboxylate |
| SMILES | CCOC(=O)CCCc1ccc2c(c1)C1(CCN(C(=O)OC(C)(C)C)C1)CN2C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C28H44N2O6Si/c1-8-34-24(31)11-9-10-21-12-13-23-22(18-21)28(14-15-29(19-28)25(32)36-27(2,3)4)20-30(23)26(33)35-16-17-37(5,6)7/h12-13,18H,8-11,14-17,19-20H2,1-7H3 |
| InChIKey | SCYMPTXQKGFYCE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|