C18H17ClFNO2S — CID 9045013
N-(4-chloro-2-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide (PubChem CID 9045013) has the molecular formula C18H17ClFNO2S and a molecular weight of 365.86 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9045013 |
| Molecular Formula | C18H17ClFNO2S |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1ccccc1SC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H17ClFNO2S/c19-12-7-8-16(15(20)10-12)21-18(22)14-5-1-2-6-17(14)24-11-13-4-3-9-23-13/h1-2,5-8,10,13H,3-4,9,11H2,(H,21,22)/t13-/m1/s1 |
| InChIKey | IZUGDQVNZBJGHR-CYBMUJFWSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |