C18H17NO5 — CID 90451427
2-[[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]carbamoyl]benzoic acid (PubChem CID 90451427) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 90451427 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]carbamoyl]benzoic acid |
| SMILES | CC1(c2ccc(NC(=O)c3ccccc3C(=O)O)cc2)OCCO1 |
| InChI | InChI=1S/C18H17NO5/c1-18(23-10-11-24-18)12-6-8-13(9-7-12)19-16(20)14-4-2-3-5-15(14)17(21)22/h2-9H,10-11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | NUYHXDVFBNEMOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |