C17H14N2O4 — CID 122605301
2-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]carbamoyl]benzoic acid (PubChem CID 122605301) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 122605301 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C17H14N2O4/c20-15(13-3-1-2-4-14(13)17(21)22)19-12-7-5-11(6-8-12)16-18-9-10-23-16/h1-8H,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | KGLIPSFJHLUBQZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |