C10H11F3N2O4 — CID 90452288
N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 90452288) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90452288 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C=CC(=O)N1CCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O4/c11-10(12,13)9(18)14-3-5-19-6-4-15-7(16)1-2-8(15)17/h1-2H,3-6H2,(H,14,18) |
| InChIKey | JQXSJEAUHVGRRH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|