C8H7F3N2O4 — CID 66692797
[1-amino-2-(2,5-dioxopyrrol-1-yl)ethyl] 2,2,2-trifluoroacetate (PubChem CID 66692797) has the molecular formula C8H7F3N2O4 and a molecular weight of 252.15 g/mol. Its IUPAC name is [1-amino-2-(2,5-dioxopyrrol-1-yl)ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-amino-2-(2,5-dioxopyrrol-1-yl)ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66692797 |
| Molecular Formula | C8H7F3N2O4 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | [1-amino-2-(2,5-dioxopyrrol-1-yl)ethyl] 2,2,2-trifluoroacetate |
| SMILES | NC(CN1C(=O)C=CC1=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O4/c9-8(10,11)7(16)17-4(12)3-13-5(14)1-2-6(13)15/h1-2,4H,3,12H2 |
| InChIKey | HIKCMPRNSPVLIY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|