C11H16N2O4 — CID 90457852
tert-butyl 2-amino-3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 90457852) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | tert-butyl 2-amino-3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 90457852 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | tert-butyl 2-amino-3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,3)17-10(16)7(12)6-13-8(14)4-5-9(13)15/h4-5,7H,6,12H2,1-3H3 |
| InChIKey | TUOVTTHNZDKMLO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|