C10H15NO3 — CID 121483270
1-(3-hydroxy-2,3-dimethylbutyl)pyrrole-2,5-dione (PubChem CID 121483270) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(3-hydroxy-2,3-dimethylbutyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-hydroxy-2,3-dimethylbutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 121483270 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-(3-hydroxy-2,3-dimethylbutyl)pyrrole-2,5-dione |
| SMILES | CC(CN1C(=O)C=CC1=O)C(C)(C)O |
| InChI | InChI=1S/C10H15NO3/c1-7(10(2,3)14)6-11-8(12)4-5-9(11)13/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | XBMQQUAEZGMOCZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|