C11H10N2O5 — CID 67861076
1-[1-(2,5-dioxopyrrol-1-yl)propan-2-yl]-3-hydroxypyrrole-2,5-dione (PubChem CID 67861076) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1-[1-(2,5-dioxopyrrol-1-yl)propan-2-yl]-3-hydroxypyrrole-2,5-dione.
| Compound Name | 1-[1-(2,5-dioxopyrrol-1-yl)propan-2-yl]-3-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 67861076 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-[1-(2,5-dioxopyrrol-1-yl)propan-2-yl]-3-hydroxypyrrole-2,5-dione |
| SMILES | CC(CN1C(=O)C=CC1=O)N1C(=O)C=C(O)C1=O |
| InChI | InChI=1S/C11H10N2O5/c1-6(5-12-8(15)2-3-9(12)16)13-10(17)4-7(14)11(13)18/h2-4,6,14H,5H2,1H3 |
| InChIKey | UZCKDYQQCYQOSK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|