C10H12F2N2O — CID 90459366
2-[1-(2,2-difluoropropanoyl)piperidin-4-ylidene]acetonitrile (PubChem CID 90459366) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-[1-(2,2-difluoropropanoyl)piperidin-4-ylidene]acetonitrile.
| Compound Name | 2-[1-(2,2-difluoropropanoyl)piperidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 90459366 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-[1-(2,2-difluoropropanoyl)piperidin-4-ylidene]acetonitrile |
| SMILES | CC(F)(F)C(=O)N1CCC(=CC#N)CC1 |
| InChI | InChI=1S/C10H12F2N2O/c1-10(11,12)9(15)14-6-3-8(2-5-13)4-7-14/h2H,3-4,6-7H2,1H3 |
| InChIKey | AMZCSRXCCNPTPG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|