C14H10F2INOS — CID 9045999
2-(2,5-difluorophenyl)sulfanyl-N-(3-iodophenyl)acetamide (PubChem CID 9045999) has the molecular formula C14H10F2INOS and a molecular weight of 405.21 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanyl-N-(3-iodophenyl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)sulfanyl-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 9045999 |
| Molecular Formula | C14H10F2INOS |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanyl-N-(3-iodophenyl)acetamide |
| SMILES | O=C(CSc1cc(F)ccc1F)Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H10F2INOS/c15-9-4-5-12(16)13(6-9)20-8-14(19)18-11-3-1-2-10(17)7-11/h1-7H,8H2,(H,18,19) |
| InChIKey | SUDMDKKZEHZZKD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|