C10H13NO5 — CID 90466897
methyl (2S,3S)-2-amino-2-deuterio-3-hydroxy-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate (PubChem CID 90466897) has the molecular formula C10H13NO5 and a molecular weight of 231.24 g/mol. Its IUPAC name is methyl (2S,3S)-2-amino-2-deuterio-3-hydroxy-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S,3S)-2-amino-2-deuterio-3-hydroxy-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 90466897 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | methyl (2S,3S)-2-amino-2-deuterio-3-hydroxy-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoate |
| SMILES | [2H]c1c([2H])c([C@H](O)[C@]([2H])(N)C(=O)OC)c([2H])c(O)c1O |
| InChI | InChI=1S/C10H13NO5/c1-16-10(15)8(11)9(14)5-2-3-6(12)7(13)4-5/h2-4,8-9,12-14H,11H2,1H3/t8-,9-/m0/s1/i2D,3D,4D,8D |
| InChIKey | CDVZDLOJFHGHRS-YXMMYCPGSA-N |
| XLogP | -0.37 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|