C11H15NO5 — CID 90467051
ethyl (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-hydroxy-3-(2,3,6-trideuterio-4,5-dideuteriooxyphenyl)propanoate (PubChem CID 90467051) has the molecular formula C11H15NO5 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-hydroxy-3-(2,3,6-trideuterio-4,5-dideuteriooxyphenyl)propanoate.
| Compound Name | ethyl (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-hydroxy-3-(2,3,6-trideuterio-4,5-dideuteriooxyphenyl)propanoate |
|---|---|
| PubChem CID | 90467051 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | ethyl (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-hydroxy-3-(2,3,6-trideuterio-4,5-dideuteriooxyphenyl)propanoate |
| SMILES | [2H]Oc1c([2H])c([2H])c([C@]([2H])(O)[C@@]([2H])(C(=O)OCC)N([2H])[2H])c([2H])c1O[2H] |
| InChI | InChI=1S/C11H15NO5/c1-2-17-11(16)9(12)10(15)6-3-4-7(13)8(14)5-6/h3-5,9-10,13-15H,2,12H2,1H3/t9-,10-/m0/s1/i3D,4D,5D,9D,10D/hD4 |
| InChIKey | AWRQZFQCRWFSRX-DGAWQGGESA-N |
| XLogP | 0.02 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|