C9H11NO5 — CID 90466169
(2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (PubChem CID 90466169) has the molecular formula C9H11NO5 and a molecular weight of 217.21 g/mol. Its IUPAC name is (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid.
| Compound Name | (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 90466169 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (2S,3R)-2,3-dideuterio-2-(dideuterioamino)-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| SMILES | [2H]N([2H])[C@]([2H])(C(=O)O)[C@]([2H])(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8+/m0/s1/i7D,8D/hD2 |
| InChIKey | QXWYKJLNLSIPIN-PVCSEHSLSA-N |
| XLogP | -0.46 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|